CAS 465514-21-0 is the registry number for 4-[(1,1-Dioxo-1lambda6,4-thiazinan-4-yl)methyl]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]benzoic acid (CAS 465514-21-0) is a chemical compound with the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. IUPAC name: 4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]benzoic acid. InChIKey: HMVAVIKQXATKEL-UHFFFAOYSA-N.
| Molecular formula | C12H15NO4S |
|---|---|
| Molecular weight | 269.32 g/mol |
| IUPAC name | 4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]benzoic acid |
| InChIKey | HMVAVIKQXATKEL-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1CC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)