Products 465514-21-0

CAS 465514-21-0 is the registry number for 4-[(1,1-Dioxo-1lambda6,4-thiazinan-4-yl)methyl]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]benzoic acid (CAS 465514-21-0) is a chemical compound with the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. IUPAC name: 4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]benzoic acid. InChIKey: HMVAVIKQXATKEL-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15NO4S
Molecular weight269.32 g/mol
IUPAC name4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]benzoic acid
InChIKeyHMVAVIKQXATKEL-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CCN1CC2=CC=C(C=C2)C(=O)O

Computed by PubChem (NCBI)