cas: 117-47-5 — see every product listed under this CAS number, including other names
Diethyl 2-(pentan-2-yl)malonate 97% (CAS 117-47-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A210069-1g |
| cas | 117-47-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 364.81 Pln | |
| Ambeed | 10g | 592.88 Pln | |
| Ambeed | 25g | 1210.31 Pln | |
| Ambeed | 100g | 3724.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A210069 |
Diethyl 2-pentan-2-ylpropanedioate (CAS 117-47-5) is a chemical compound with the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. IUPAC name: diethyl 2-pentan-2-ylpropanedioate. InChIKey: RQFSNEWORATSCC-UHFFFAOYSA-N.
| Molecular formula | C12H22O4 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | diethyl 2-pentan-2-ylpropanedioate |
| InChIKey | RQFSNEWORATSCC-UHFFFAOYSA-N |
| SMILES | CCCC(C)C(C(=O)OCC)C(=O)OCC |
Computed by PubChem (NCBI)