cas: 90794-84-6 — see every product listed under this CAS number, including other names
Diethyl 2-chloropyrimidine-4,5-dicarboxylate, 98% (CAS 90794-84-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F215172-100MG |
| cas | 90794-84-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 471.73 Pln | |
| Fluorochem | 250mg | 607.10 Pln | |
| Fluorochem | 500mg | 1044.44 Pln | |
| Fluorochem | 1g | 1440.14 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Diethyl 2-chloropyrimidine-4,5-dicarboxylate (CAS 90794-84-6) is a chemical compound with the molecular formula C10H11ClN2O4 and a molecular weight of 258.66 g/mol. IUPAC name: diethyl 2-chloropyrimidine-4,5-dicarboxylate. InChIKey: VHQAZEHEYSOONS-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O4 |
|---|---|
| Molecular weight | 258.66 g/mol |
| IUPAC name | diethyl 2-chloropyrimidine-4,5-dicarboxylate |
| InChIKey | VHQAZEHEYSOONS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(N=C1C(=O)OCC)Cl |
Computed by PubChem (NCBI)