cas: 90794-84-6 — see every product listed under this CAS number, including other names
diethyl 2-chloropyrimidine-4,5-dicarboxylate, 97%, 97% (CAS 90794-84-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114PFK-100mg |
| cas | 90794-84-6 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 352.40 Pln | |
| Chemat | 250mg | 645.20 Pln | |
| Chemat | 500mg | 1034.00 Pln | |
| Chemat | 1g | 1562.00 Pln | |
| Chemat | 5g | 5310.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Diethyl 2-chloropyrimidine-4,5-dicarboxylate (CAS 90794-84-6) is a chemical compound with the molecular formula C10H11ClN2O4 and a molecular weight of 258.66 g/mol. IUPAC name: diethyl 2-chloropyrimidine-4,5-dicarboxylate. InChIKey: VHQAZEHEYSOONS-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O4 |
|---|---|
| Molecular weight | 258.66 g/mol |
| IUPAC name | diethyl 2-chloropyrimidine-4,5-dicarboxylate |
| InChIKey | VHQAZEHEYSOONS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(N=C1C(=O)OCC)Cl |
Computed by PubChem (NCBI)