Products 547698-11-3
CAS 547698-11-3 is the registry number for 3-Chloro-n-(2-methoxy-4-nitrophenyl)propanamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
3-chloro-N-(2-methoxy-4-nitrophenyl)propanamide (CAS 547698-11-3) is a chemical compound with the molecular formula C10H11ClN2O4 and a molecular weight of 258.66 g/mol. IUPAC name: 3-chloro-N-(2-methoxy-4-nitrophenyl)propanamide. InChIKey: KOQBHLMOVWSUCQ-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O4 |
|---|---|
| Molecular weight | 258.66 g/mol |
| IUPAC name | 3-chloro-N-(2-methoxy-4-nitrophenyl)propanamide |
| InChIKey | KOQBHLMOVWSUCQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)[N+](=O)[O-])NC(=O)CCCl |
Computed by PubChem (NCBI)