Diethyl 2-isopentylmalonate, 96%, 96%
cas: 5398-08-3 — see every product listed under this CAS number, including other names
Diethyl 2-isopentylmalonate, 96%, 96% (CAS 5398-08-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I0MP-250mg |
| cas | 5398-08-3 |
| size | 250mg |
| availability | 200g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 285.20 Pln | |
| Chemat | 10g | 501.20 Pln | |
| Chemat | 25g | 1024.40 Pln | |
| Chemat | 50g | 1888.40 Pln | |
| Chemat | 100g | 3050.00 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Diethyl 2-(3-methylbutyl)propanedioate (CAS 5398-08-3) is a chemical compound with the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. IUPAC name: diethyl 2-(3-methylbutyl)propanedioate. InChIKey: MPJCIHOJXMCSIM-UHFFFAOYSA-N.
| Molecular formula | C12H22O4 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | diethyl 2-(3-methylbutyl)propanedioate |
| InChIKey | MPJCIHOJXMCSIM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CCC(C)C)C(=O)OCC |
Computed by PubChem (NCBI)
Synonyms:
Diethyl isopentylmalonate, DIETHYL ISOAMYLMALONATE, Diethyl 2-isopentylmalonate, diethyl 2-(3-methylbutyl)propanedioate, 2-(3-methylbutyl)propanedioic acid diethyl ester, Propanedioic acid, (3-methylbutyl)-, diethyl ester, Diethyl2-isopentylmalonate, 1,3-diethyl 2-(3-methylbutyl)propanedioate, Diethyl 3-methylbutylmalonate, diethyl 2-isopentylpropanedioate