cas: 104097-04-3 — see every product listed under this CAS number, including other names
Diethyl 3-Nitrobenzylphosphonate, 95-<97% (CAS 104097-04-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC1377-95-97-25g |
| cas | 104097-04-3 |
| size | 25g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 25g | 5284.40 Pln | |
| Hoffman Fine Chemicals | 50g | 8270.24 Pln | |
| Hoffman Fine Chemicals | 100g | 13048.86 Pln | |
| Hoffman Fine Chemicals | 200g | 20692.10 Pln | |
| Hoffman Fine Chemicals | 300g | 26300.12 Pln | |
| Hoffman Fine Chemicals | 400g | 29764.46 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
1-(diethoxyphosphorylmethyl)-3-nitrobenzene (CAS 104097-04-3) is a chemical compound with the molecular formula C11H16NO5P and a molecular weight of 273.22 g/mol. IUPAC name: 1-(diethoxyphosphorylmethyl)-3-nitrobenzene. InChIKey: QNHAEKQJZUMZFT-UHFFFAOYSA-N.
| Molecular formula | C11H16NO5P |
|---|---|
| Molecular weight | 273.22 g/mol |
| IUPAC name | 1-(diethoxyphosphorylmethyl)-3-nitrobenzene |
| InChIKey | QNHAEKQJZUMZFT-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CC1=CC(=CC=C1)[N+](=O)[O-])OCC |
Computed by PubChem (NCBI)