CAS 104097-04-3 appears in our catalog under these names: Diethyl 3–Nitrobenzylphosphonate, Diethyl 3-nitrobenzylphosphonate, 95%, Diethyl 3-Nitrobenzylphosphonate 95+%, Diethyl 3-nitrobenzylphosphonate, 96%, Diethyl 3-Nitrobenzylphosphonate, 95-<97%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem, Hoffman Fine Chemicals. Available pack sizes: 1g, 250mg, 25g, 5g, 100mg, 10g, 50g, 100g.
1-(diethoxyphosphorylmethyl)-3-nitrobenzene (CAS 104097-04-3) is a chemical compound with the molecular formula C11H16NO5P and a molecular weight of 273.22 g/mol. IUPAC name: 1-(diethoxyphosphorylmethyl)-3-nitrobenzene. InChIKey: QNHAEKQJZUMZFT-UHFFFAOYSA-N.
| Molecular formula | C11H16NO5P |
|---|---|
| Molecular weight | 273.22 g/mol |
| IUPAC name | 1-(diethoxyphosphorylmethyl)-3-nitrobenzene |
| InChIKey | QNHAEKQJZUMZFT-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CC1=CC(=CC=C1)[N+](=O)[O-])OCC |
Computed by PubChem (NCBI)