cas: 104097-04-3 — see every product listed under this CAS number, including other names
Diethyl 3-nitrobenzylphosphonate, 96% (CAS 104097-04-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F620253-250MG |
| cas | 104097-04-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 200.99 Pln | |
| Fluorochem | 5g | 778.91 Pln | |
| Fluorochem | 10g | 1497.41 Pln | |
| Fluorochem | 25g | 3642.49 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
1-(diethoxyphosphorylmethyl)-3-nitrobenzene (CAS 104097-04-3) is a chemical compound with the molecular formula C11H16NO5P and a molecular weight of 273.22 g/mol. IUPAC name: 1-(diethoxyphosphorylmethyl)-3-nitrobenzene. InChIKey: QNHAEKQJZUMZFT-UHFFFAOYSA-N.
| Molecular formula | C11H16NO5P |
|---|---|
| Molecular weight | 273.22 g/mol |
| IUPAC name | 1-(diethoxyphosphorylmethyl)-3-nitrobenzene |
| InChIKey | QNHAEKQJZUMZFT-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CC1=CC(=CC=C1)[N+](=O)[O-])OCC |
Computed by PubChem (NCBI)