Diethyl 4,4-difluoroheptanedioate, 96%
cas: 22515-16-8 — see every product listed under this CAS number, including other names
Diethyl 4,4-difluoroheptanedioate, 96% (CAS 22515-16-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1148IS-250mg |
| cas | 22515-16-8 |
| size | 250mg |
| availability | 20g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 328.40 Pln | |
| Chemat | 10g | 597.20 Pln | |
| Fluorochem | 250mg | 102.06 Pln | |
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 388.42 Pln | |
| Fluorochem | 10g | 700.81 Pln | |
| Fluorochem | 25g | 1523.44 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Diethyl 4,4-difluoroheptanedioate (CAS 22515-16-8) is a chemical compound with the molecular formula C11H18F2O4 and a molecular weight of 252.25 g/mol. IUPAC name: diethyl 4,4-difluoroheptanedioate. InChIKey: XUOBBVMKXUPPEW-UHFFFAOYSA-N.
| Molecular formula | C11H18F2O4 |
|---|---|
| Molecular weight | 252.25 g/mol |
| IUPAC name | diethyl 4,4-difluoroheptanedioate |
| InChIKey | XUOBBVMKXUPPEW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCC(CCC(=O)OCC)(F)F |
Computed by PubChem (NCBI)
Synonyms:
Diethyl 4,4-difluoroheptanedioate, 1,7-diethyl 4,4-difluoroheptanedioate, Diethyl 4,4-difluoropimelate, Diethyl4,4-difluoroheptanedioate, Diethyl 4,4-difluoroheptane-1,7-dioate, 4,4-difluoro-heptanedioic acid diethyl ester, Diethyl 4,4-difluoroheptanedio, Diethyl 4,4-difluoropimelate,, 4,4-Difluoro heptanoic acid diethyl ester, Diethyl 4,4-difluoroheptane-1,7-dioate 96%