cas: 1196155-10-8 — see every product listed under this CAS number, including other names
Diethyl 4-Aminopyridine-2,6-dicarboxylate, ≥95%, ≥95% (CAS 1196155-10-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FLJG-100mg |
| cas | 1196155-10-8 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1965.20 Pln | |
| Chemat | 1g | 4542.80 Pln | |
| Chemat | 5g | 10398.80 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
Diethyl 4-aminopyridine-2,6-dicarboxylate (CAS 1196155-10-8) is a chemical compound with the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. IUPAC name: diethyl 4-aminopyridine-2,6-dicarboxylate. InChIKey: AHJBORNYMQMCBC-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O4 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | diethyl 4-aminopyridine-2,6-dicarboxylate |
| InChIKey | AHJBORNYMQMCBC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC(=N1)C(=O)OCC)N |
Computed by PubChem (NCBI)