CAS 926261-98-5 appears in our catalog under these names: 1-[(5-Methylisoxazol-4-yl)carbonyl]piperidine-4-carboxylic acid, 95%, 1-(5-Methyl-1,2-oxazole-4-carbonyl)piperidine-4-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1-(5-methyl-1,2-oxazole-4-carbonyl)piperidine-4-carboxylic acid (CAS 926261-98-5) is a chemical compound with the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. IUPAC name: 1-(5-methyl-1,2-oxazole-4-carbonyl)piperidine-4-carboxylic acid. InChIKey: XDQUCSOBVMOHSF-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O4 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 1-(5-methyl-1,2-oxazole-4-carbonyl)piperidine-4-carboxylic acid |
| InChIKey | XDQUCSOBVMOHSF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NO1)C(=O)N2CCC(CC2)C(=O)O |
Computed by PubChem (NCBI)