CAS 2375247-60-0 is the registry number for Methyl (2r)-2-(2-aminoacetamido)-2-(4-hydroxyphenyl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.
Methyl (2R)-2-[(2-aminoacetyl)amino]-2-(4-hydroxyphenyl)acetate (CAS 2375247-60-0) is a chemical compound with the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. IUPAC name: methyl (2R)-2-[(2-aminoacetyl)amino]-2-(4-hydroxyphenyl)acetate. InChIKey: MTUQNXMZBMWXEB-SNVBAGLBSA-N.
| Molecular formula | C11H14N2O4 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | methyl (2R)-2-[(2-aminoacetyl)amino]-2-(4-hydroxyphenyl)acetate |
| InChIKey | MTUQNXMZBMWXEB-SNVBAGLBSA-N |
| SMILES | COC(=O)[C@@H](C1=CC=C(C=C1)O)NC(=O)CN |
Computed by PubChem (NCBI)