Products 1539-59-9

CAS 1539-59-9 is the registry number for Diethyl 4-cyclohexyl-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Diethyl 4-cyclohexyl-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (CAS 1539-59-9) is a chemical compound with the molecular formula C19H29NO4 and a molecular weight of 335.4 g/mol. IUPAC name: diethyl 4-cyclohexyl-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: GERWBKSVDHUVIT-UHFFFAOYSA-N.

Identity
Molecular formulaC19H29NO4
Molecular weight335.4 g/mol
IUPAC namediethyl 4-cyclohexyl-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate
InChIKeyGERWBKSVDHUVIT-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(NC(=C(C1C2CCCCC2)C(=O)OCC)C)C

Computed by PubChem (NCBI)