cas: 121021-24-7 — see every product listed under this CAS number, including other names
Diisopropyl (3,3-dimethylbut-1-yn-1-yl)boronate 95% (CAS 121021-24-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A832112-50mg |
| cas | 121021-24-7 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 759.75 Pln | |
| Ambeed | 100mg | 1054.56 Pln | |
| Ambeed | 250mg | 1911.19 Pln | |
| Ambeed | 1g | 5176.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A832112 |
3,3-dimethylbut-1-ynyl-di(propan-2-yloxy)borane (CAS 121021-24-7) is a chemical compound with the molecular formula C12H23BO2 and a molecular weight of 210.12 g/mol. IUPAC name: 3,3-dimethylbut-1-ynyl-di(propan-2-yloxy)borane. InChIKey: FLHZJMZNIOCRSX-UHFFFAOYSA-N.
| Molecular formula | C12H23BO2 |
|---|---|
| Molecular weight | 210.12 g/mol |
| IUPAC name | 3,3-dimethylbut-1-ynyl-di(propan-2-yloxy)borane |
| InChIKey | FLHZJMZNIOCRSX-UHFFFAOYSA-N |
| SMILES | B(C#CC(C)(C)C)(OC(C)C)OC(C)C |
Computed by PubChem (NCBI)