CAS 1073354-67-2 appears in our catalog under these names: 4,4,5,5-Tetramethyl-2-(4-methyl-3-penten-1-yl)-1,3,2-dioxaborolane, 4,4,5,5-Tetramethyl-2-(4-methylpent-3-en-1-yl)-1,3,2-dioxaborolane 98%. Offered by: TRC, Ambeed. Available pack sizes: 250mg, 500mg, 50mg, 100mg, 1g.
4,4,5,5-tetramethyl-2-(4-methylpent-3-enyl)-1,3,2-dioxaborolane (CAS 1073354-67-2) is a chemical compound with the molecular formula C12H23BO2 and a molecular weight of 210.12 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-methylpent-3-enyl)-1,3,2-dioxaborolane. InChIKey: WHSCXARPDWZZRD-UHFFFAOYSA-N.
| Molecular formula | C12H23BO2 |
|---|---|
| Molecular weight | 210.12 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-methylpent-3-enyl)-1,3,2-dioxaborolane |
| InChIKey | WHSCXARPDWZZRD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCC=C(C)C |
Computed by PubChem (NCBI)