CAS 87100-15-0 appears in our catalog under these names: 2–Cyclohexyl–4,4,5,5–tetramethyl –1,3,2–dioxaborolane, Cyclohexylboronic acid pinacol ester, 97% , 2-Cyclohexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, >97.0%(GC)(T), 2-Cyclohexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98%, 2-Cyclohexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 100g, 10g, 25g, 1g, 5g.
2-cyclohexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 87100-15-0) is a chemical compound with the molecular formula C12H23BO2 and a molecular weight of 210.12 g/mol. IUPAC name: 2-cyclohexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: OUEVCDGYTKLNMJ-UHFFFAOYSA-N.
| Molecular formula | C12H23BO2 |
|---|---|
| Molecular weight | 210.12 g/mol |
| IUPAC name | 2-cyclohexyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | OUEVCDGYTKLNMJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCCCC2 |
Computed by PubChem (NCBI)