Dimethyl 2-iodoterephthalate, 98%
cas: 165534-79-2 — see every product listed under this CAS number, including other names
Dimethyl 2-iodoterephthalate, 98% (CAS 165534-79-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A706737-250mg |
| cas | 165534-79-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 1171.38 Pln | |
| Ambeed | 25g | 3424.19 Pln | |
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 290.00 Pln | |
| Chemat | 5g | 890.00 Pln | |
| BLDpharm | 250mg | 142.20 Pln | |
| BLDpharm | 1g | 342.13 Pln | |
| BLDpharm | 5g | 1258.47 Pln | |
| BLDpharm | 25g | 3685.39 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Dimethyl 2-iodobenzene-1,4-dicarboxylate (CAS 165534-79-2) is a chemical compound with the molecular formula C10H9IO4 and a molecular weight of 320.08 g/mol. IUPAC name: dimethyl 2-iodobenzene-1,4-dicarboxylate. InChIKey: GJVIVAYVYHUGOO-UHFFFAOYSA-N.
| Molecular formula | C10H9IO4 |
|---|---|
| Molecular weight | 320.08 g/mol |
| IUPAC name | dimethyl 2-iodobenzene-1,4-dicarboxylate |
| InChIKey | GJVIVAYVYHUGOO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C(=O)OC)I |
Computed by PubChem (NCBI)
Synonyms:
Dimethyl iodoterephthalate, dimethyl 2-iodoterephthalate, dimethyl 2-iodobenzene-1,4-dicarboxylate, 1,4-Benzenedicarboxylic acid, 2-iodo-, 1,4-dimethyl ester, 1,4-dimethyl 2-iodobenzene-1,4-dicarboxylate, 2-Iodo-terephthalic acid dimethyl ester, 2-Iodoterephthalic acid dimethyl ester, Dimethyl 2-iodoterephthalic acid, 2-iodo-3,5-dimethylterephthalate, GJVIVAYVYHUGOO-UHFFFAOYSA-N