Products 2803902-35-2

CAS 2803902-35-2 is the registry number for 3-(Ethoxycarbonyl)-2-iodobenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-ethoxycarbonyl-2-iodobenzoic acid (CAS 2803902-35-2) is a chemical compound with the molecular formula C10H9IO4 and a molecular weight of 320.08 g/mol. IUPAC name: 3-ethoxycarbonyl-2-iodobenzoic acid. InChIKey: IGQRMWVKFLXQOG-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9IO4
Molecular weight320.08 g/mol
IUPAC name3-ethoxycarbonyl-2-iodobenzoic acid
InChIKeyIGQRMWVKFLXQOG-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC=CC(=C1I)C(=O)O

Computed by PubChem (NCBI)