Products 59340-47-5

CAS 59340-47-5 is the registry number for Dimethyl 4-Iodophthalate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Dimethyl 4-iodobenzene-1,2-dicarboxylate (CAS 59340-47-5) is a chemical compound with the molecular formula C10H9IO4 and a molecular weight of 320.08 g/mol. IUPAC name: dimethyl 4-iodobenzene-1,2-dicarboxylate. InChIKey: JVLGGEVUYARXHI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9IO4
Molecular weight320.08 g/mol
IUPAC namedimethyl 4-iodobenzene-1,2-dicarboxylate
InChIKeyJVLGGEVUYARXHI-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=C(C=C1)I)C(=O)OC

Computed by PubChem (NCBI)