cas: 16691-79-5 — see every product listed under this CAS number, including other names
Dimethyl 2-oxo-4,5-diphenylcyclopenta-3,5-diene-1,3-dicarboxylate (CAS 16691-79-5) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112X1R-200mg |
| cas | 16691-79-5 |
| size | 200mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 126.80 Pln | |
| Chemat | 1g | 294.80 Pln | |
| Chemat | 5g | 1144.40 Pln |
| delivery time | 3 weeks |
|---|
Dimethyl 2-oxo-4,5-diphenylcyclopenta-3,5-diene-1,3-dicarboxylate (CAS 16691-79-5) is a chemical compound with the molecular formula C21H16O5 and a molecular weight of 348.3 g/mol. IUPAC name: dimethyl 2-oxo-4,5-diphenylcyclopenta-3,5-diene-1,3-dicarboxylate. InChIKey: NTXFYWYVVGMAGT-UHFFFAOYSA-N.
| Molecular formula | C21H16O5 |
|---|---|
| Molecular weight | 348.3 g/mol |
| IUPAC name | dimethyl 2-oxo-4,5-diphenylcyclopenta-3,5-diene-1,3-dicarboxylate |
| InChIKey | NTXFYWYVVGMAGT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C1=O)C(=O)OC)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)