cas: 38289-18-8 — see every product listed under this CAS number, including other names
Dimethyl 4-cyano-4-phenylheptanedioate 95% (CAS 38289-18-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A399291-50mg |
| cas | 38289-18-8 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 542.81 Pln | |
| Ambeed | 100mg | 871.00 Pln | |
| Ambeed | 250mg | 1505.12 Pln | |
| Ambeed | 1g | 3502.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A399291 |
Dimethyl 4-cyano-4-phenylheptanedioate (CAS 38289-18-8) is a chemical compound with the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. IUPAC name: dimethyl 4-cyano-4-phenylheptanedioate. InChIKey: HCUUFVRSNZOLLK-UHFFFAOYSA-N.
| Molecular formula | C16H19NO4 |
|---|---|
| Molecular weight | 289.33 g/mol |
| IUPAC name | dimethyl 4-cyano-4-phenylheptanedioate |
| InChIKey | HCUUFVRSNZOLLK-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC(CCC(=O)OC)(C#N)C1=CC=CC=C1 |
Computed by PubChem (NCBI)