Products 1890353-78-2
CAS 1890353-78-2 is the registry number for 8-(Benzyloxycarbonyl)-8-azabicyclo[3.2.1]octane-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
(1R,5S)-8-phenylmethoxycarbonyl-8-azabicyclo[3.2.1]octane-3-carboxylic acid (CAS 1890353-78-2) is a chemical compound with the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. IUPAC name: (1R,5S)-8-phenylmethoxycarbonyl-8-azabicyclo[3.2.1]octane-3-carboxylic acid. InChIKey: GGRXHCDVNPOPQW-AGUYFDCRSA-N.
| Molecular formula | C16H19NO4 |
|---|---|
| Molecular weight | 289.33 g/mol |
| IUPAC name | (1R,5S)-8-phenylmethoxycarbonyl-8-azabicyclo[3.2.1]octane-3-carboxylic acid |
| InChIKey | GGRXHCDVNPOPQW-AGUYFDCRSA-N |
| SMILES | C1C[C@H]2CC(C[C@@H]1N2C(=O)OCC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)