Products 850407-50-0
CAS 850407-50-0 is the registry number for 1-tert-Butyl 5-ethyl 1h-indole-1,5-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-O-tert-butyl 5-O-ethyl indole-1,5-dicarboxylate (CAS 850407-50-0) is a chemical compound with the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. IUPAC name: 1-O-tert-butyl 5-O-ethyl indole-1,5-dicarboxylate. InChIKey: RDVXHQVMOBSSDY-UHFFFAOYSA-N.
| Molecular formula | C16H19NO4 |
|---|---|
| Molecular weight | 289.33 g/mol |
| IUPAC name | 1-O-tert-butyl 5-O-ethyl indole-1,5-dicarboxylate |
| InChIKey | RDVXHQVMOBSSDY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)N(C=C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)