CAS 51839-15-7 appears in our catalog under these names: Dimethyl 5-Iodoisophthalate, Dimethyl 5-Iodoisophthalate, >98.0%(GC), Dimethyl 5-iodoisophthalate, 98%, 98%, Dimethyl 5-iodoisophthalate, 95%, Dimethyl 5-iodoisophthalate, 98%. Offered by: TRC, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 5g, 10g, 250mg, 25g, 100g.
Dimethyl 5-iodobenzene-1,3-dicarboxylate (CAS 51839-15-7) is a chemical compound with the molecular formula C10H9IO4 and a molecular weight of 320.08 g/mol. IUPAC name: dimethyl 5-iodobenzene-1,3-dicarboxylate. InChIKey: DIAONVDUSXRXCE-UHFFFAOYSA-N.
| Molecular formula | C10H9IO4 |
|---|---|
| Molecular weight | 320.08 g/mol |
| IUPAC name | dimethyl 5-iodobenzene-1,3-dicarboxylate |
| InChIKey | DIAONVDUSXRXCE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)I)C(=O)OC |
Computed by PubChem (NCBI)