cas: 878197-87-6 — see every product listed under this CAS number, including other names
Dimethyl-[4-(4,4,5,5-Tetramethyl[1,3,2]Dioxaborolan-2-Yl)Benzyl]Amine, 98%, 98% (CAS 878197-87-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114K0O-250mg |
| cas | 878197-87-6 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 290.00 Pln | |
| Chemat | 5g | 914.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N,N-dimethyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine (CAS 878197-87-6) is a chemical compound with the molecular formula C15H24BNO2 and a molecular weight of 261.17 g/mol. IUPAC name: N,N-dimethyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine. InChIKey: SATLWVSJANHADH-UHFFFAOYSA-N.
| Molecular formula | C15H24BNO2 |
|---|---|
| Molecular weight | 261.17 g/mol |
| IUPAC name | N,N-dimethyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine |
| InChIKey | SATLWVSJANHADH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CN(C)C |
Computed by PubChem (NCBI)