Products 1369926-58-8

CAS 1369926-58-8 is the registry number for 4-Amino-3-isopropylphenylboronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 1369926-58-8) is a chemical compound with the molecular formula C15H24BNO2 and a molecular weight of 261.17 g/mol. IUPAC name: 2-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: YTSUGNUIHVCVEL-UHFFFAOYSA-N.

Identity
Molecular formulaC15H24BNO2
Molecular weight261.17 g/mol
IUPAC name2-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline
InChIKeyYTSUGNUIHVCVEL-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)N)C(C)C

Computed by PubChem (NCBI)