CAS 2377610-45-0 is the registry number for Methyl([2-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl])amine, 96%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanamine (CAS 2377610-45-0) is a chemical compound with the molecular formula C15H24BNO2 and a molecular weight of 261.17 g/mol. IUPAC name: N-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanamine. InChIKey: FCUNGHGFRXRMAS-UHFFFAOYSA-N.
| Molecular formula | C15H24BNO2 |
|---|---|
| Molecular weight | 261.17 g/mol |
| IUPAC name | N-methyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanamine |
| InChIKey | FCUNGHGFRXRMAS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CCNC |
Computed by PubChem (NCBI)