cas: 51767-39-6 — see every product listed under this CAS number, including other names
Dofetilide Impurity 15 98% (CAS 51767-39-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A148455-100mg |
| cas | 51767-39-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 837.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A148455 |
N-(4-hydroxyphenyl)methanesulfonamide (CAS 51767-39-6) is a chemical compound with the molecular formula C7H9NO3S and a molecular weight of 187.22 g/mol. IUPAC name: N-(4-hydroxyphenyl)methanesulfonamide. InChIKey: YJASRJZSSUOGKB-UHFFFAOYSA-N.
| Molecular formula | C7H9NO3S |
|---|---|
| Molecular weight | 187.22 g/mol |
| IUPAC name | N-(4-hydroxyphenyl)methanesulfonamide |
| InChIKey | YJASRJZSSUOGKB-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=CC=C(C=C1)O |
Computed by PubChem (NCBI)