cas: 328-93-8 — see every product listed under this CAS number, including other names
Dutasteride Impurity 3 98% (CAS 328-93-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A170198-1g |
| cas | 328-93-8 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 175.69 Pln | |
| Ambeed | 100g | 303.62 Pln | |
| Ambeed | 500g | 932.19 Pln | |
| Ambeed | 1000g | 1710.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A170198 |
2,5-bis(trifluoromethyl)aniline (CAS 328-93-8) is a chemical compound with the molecular formula C8H5F6N and a molecular weight of 229.12 g/mol. IUPAC name: 2,5-bis(trifluoromethyl)aniline. InChIKey: XWMVIJUAZAEWIE-UHFFFAOYSA-N.
| Molecular formula | C8H5F6N |
|---|---|
| Molecular weight | 229.12 g/mol |
| IUPAC name | 2,5-bis(trifluoromethyl)aniline |
| InChIKey | XWMVIJUAZAEWIE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)N)C(F)(F)F |
Computed by PubChem (NCBI)