CAS 3822-20-6 is the registry number for Dutasteride Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.
2,3-bis(trifluoromethyl)aniline (CAS 3822-20-6) is a chemical compound with the molecular formula C8H5F6N and a molecular weight of 229.12 g/mol. IUPAC name: 2,3-bis(trifluoromethyl)aniline. InChIKey: OUYTZPOGDMVMNL-UHFFFAOYSA-N.
| Molecular formula | C8H5F6N |
|---|---|
| Molecular weight | 229.12 g/mol |
| IUPAC name | 2,3-bis(trifluoromethyl)aniline |
| InChIKey | OUYTZPOGDMVMNL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)N)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)