CAS 1099597-76-8 is the registry number for 6-Methyl-2,3-bis-(trifluoromethyl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
6-methyl-2,3-bis(trifluoromethyl)pyridine (CAS 1099597-76-8) is a chemical compound with the molecular formula C8H5F6N and a molecular weight of 229.12 g/mol. IUPAC name: 6-methyl-2,3-bis(trifluoromethyl)pyridine. InChIKey: TVSKSASIHFEAQQ-UHFFFAOYSA-N.
| Molecular formula | C8H5F6N |
|---|---|
| Molecular weight | 229.12 g/mol |
| IUPAC name | 6-methyl-2,3-bis(trifluoromethyl)pyridine |
| InChIKey | TVSKSASIHFEAQQ-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(C=C1)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)