cas: 42951-68-8 — see every product listed under this CAS number, including other names
EB1 (CAS 42951-68-8) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 50mg, 100mg. Offered by: GLPBio, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC73118-1 |
| cas | 42951-68-8 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1mg | 639.16 Pln | |
| GLPBio | 10mg | 1196.14 Pln | |
| GLPBio | 25mg | 1743.76 Pln | |
| GLPBio | 5mg | 943.40 Pln | |
| GLPBio | 50mg | 2352.23 Pln | |
| Chemat | 1mg | 232.40 Pln | |
| Chemat | 5mg | 462.80 Pln | |
| Chemat | 10mg | 683.60 Pln | |
| Chemat | 25mg | 1134.80 Pln | |
| Chemat | 50mg | 1614.80 Pln | |
| Chemat | 100mg | 2291.60 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
4,6-diphenyl-2H-pyrazolo[3,4-b]pyridin-3-amine (CAS 42951-68-8) is a chemical compound with the molecular formula C18H14N4 and a molecular weight of 286.3 g/mol. IUPAC name: 4,6-diphenyl-2H-pyrazolo[3,4-b]pyridin-3-amine. InChIKey: NGNHXYCLUMQSKR-UHFFFAOYSA-N.
| Molecular formula | C18H14N4 |
|---|---|
| Molecular weight | 286.3 g/mol |
| IUPAC name | 4,6-diphenyl-2H-pyrazolo[3,4-b]pyridin-3-amine |
| InChIKey | NGNHXYCLUMQSKR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC3=NNC(=C23)N)C4=CC=CC=C4 |
Computed by PubChem (NCBI)