CAS 42951-68-8 appears in our catalog under these names: EB1, 98%, EB1/ 99.82% (existing batch purity), EB1, EB1, 99.91%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1g, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
4,6-diphenyl-2H-pyrazolo[3,4-b]pyridin-3-amine (CAS 42951-68-8) is a chemical compound with the molecular formula C18H14N4 and a molecular weight of 286.3 g/mol. IUPAC name: 4,6-diphenyl-2H-pyrazolo[3,4-b]pyridin-3-amine. InChIKey: NGNHXYCLUMQSKR-UHFFFAOYSA-N.
| Molecular formula | C18H14N4 |
|---|---|
| Molecular weight | 286.3 g/mol |
| IUPAC name | 4,6-diphenyl-2H-pyrazolo[3,4-b]pyridin-3-amine |
| InChIKey | NGNHXYCLUMQSKR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC3=NNC(=C23)N)C4=CC=CC=C4 |
Computed by PubChem (NCBI)