Products 100146-16-5
CAS 100146-16-5 appears in our catalog under these names: Daclatasvir Impurity 36, Daclatasvir Impurity 29. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-[4-[4-(1H-imidazol-5-yl)phenyl]phenyl]-1H-imidazole (CAS 100146-16-5) is a chemical compound with the molecular formula C18H14N4 and a molecular weight of 286.3 g/mol. IUPAC name: 5-[4-[4-(1H-imidazol-5-yl)phenyl]phenyl]-1H-imidazole. InChIKey: JHUZGJNYFDJSGF-UHFFFAOYSA-N.
| Molecular formula | C18H14N4 |
|---|---|
| Molecular weight | 286.3 g/mol |
| IUPAC name | 5-[4-[4-(1H-imidazol-5-yl)phenyl]phenyl]-1H-imidazole |
| InChIKey | JHUZGJNYFDJSGF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)C3=CN=CN3)C4=CN=CN4 |
Computed by PubChem (NCBI)