cas: 1951439-51-2 — see every product listed under this CAS number, including other names
ENDO-BCN-PEG2-ALCOHOL, 95%, 95% (CAS 1951439-51-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I476-50mg |
| cas | 1951439-51-2 |
| size | 50mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 549.20 Pln | |
| Chemat | 100mg | 842.00 Pln | |
| Chemat | 250mg | 1389.20 Pln | |
| Chemat | 1g | 4302.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]carbamate (CAS 1951439-51-2) is a chemical compound with the molecular formula C17H27NO5 and a molecular weight of 325.4 g/mol. IUPAC name: [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]carbamate. InChIKey: PEXDOIHAKXYTET-XYPWUTKMSA-N.
| Molecular formula | C17H27NO5 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]carbamate |
| InChIKey | PEXDOIHAKXYTET-XYPWUTKMSA-N |
| SMILES | C1C[C@@H]2[C@@H](C2COC(=O)NCCOCCOCCO)CCC#C1 |
Computed by PubChem (NCBI)