CAS 709031-31-2 is the registry number for Boc-3-hydroxy-1-adamantyl-DL-glycine. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 250mg.
2-(3-hydroxy-1-adamantyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 709031-31-2) is a chemical compound with the molecular formula C17H27NO5 and a molecular weight of 325.4 g/mol. IUPAC name: 2-(3-hydroxy-1-adamantyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: UKCKDSNFBFHSHC-UHFFFAOYSA-N.
| Molecular formula | C17H27NO5 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 2-(3-hydroxy-1-adamantyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | UKCKDSNFBFHSHC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)O)C12CC3CC(C1)CC(C3)(C2)O |
Computed by PubChem (NCBI)