CAS 361442-00-4 appears in our catalog under these names: Saxagliptin Impurity 37, Boc-3-hydroxy-1-adamantyl-D-glycine, >95% (HPLC), (2S)-((tert-Butoxycarbonyl)amino)-2-(3-hydroxytricyclo(3.3.1.1(3,7))dec-1-yl)acetic Acid, Saxagliptin Impurity 23 97%, (2S)-[(tert-Butoxycarbonyl)amino](3-hydroxytricyclo[3.3.1.13,7]decan-1-yl)ethanoic acid, 97%, 97%. Offered by: Chemat Brand, TRC, Mikromol, Ambeed, Chemat. Available pack sizes: on request, 10g, 5g, 25mg, 250mg, 1g, 25g, 100g.
(2S)-2-(3-hydroxy-1-adamantyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 361442-00-4) is a chemical compound with the molecular formula C17H27NO5 and a molecular weight of 325.4 g/mol. IUPAC name: (2S)-2-(3-hydroxy-1-adamantyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: UKCKDSNFBFHSHC-ZEJPWUNMSA-N.
| Molecular formula | C17H27NO5 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | (2S)-2-(3-hydroxy-1-adamantyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | UKCKDSNFBFHSHC-ZEJPWUNMSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)O)C12CC3CC(C1)CC(C3)(C2)O |
Computed by PubChem (NCBI)