Products 187400-85-7
CAS 187400-85-7 appears in our catalog under these names: ER 50891/ 99.49% (existing batch purity), ER 50891, ER 50891, ER 50891, 99.86%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
4-[5-(4-phenyl-8-propan-2-ylquinolin-2-yl)-1H-pyrrol-2-yl]benzoic acid (CAS 187400-85-7) is a chemical compound with the molecular formula C29H24N2O2 and a molecular weight of 432.5 g/mol. IUPAC name: 4-[5-(4-phenyl-8-propan-2-ylquinolin-2-yl)-1H-pyrrol-2-yl]benzoic acid. InChIKey: LSGNKLDHMQVTEK-UHFFFAOYSA-N.
| Molecular formula | C29H24N2O2 |
|---|---|
| Molecular weight | 432.5 g/mol |
| IUPAC name | 4-[5-(4-phenyl-8-propan-2-ylquinolin-2-yl)-1H-pyrrol-2-yl]benzoic acid |
| InChIKey | LSGNKLDHMQVTEK-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=CC2=C1N=C(C=C2C3=CC=CC=C3)C4=CC=C(N4)C5=CC=C(C=C5)C(=O)O |
Computed by PubChem (NCBI)