Products 55854-43-8
CAS 55854-43-8 appears in our catalog under these names: ES9–17, ES9-17/ 99.81% (existing batch purity), ES9-17, ES9-17, 98%, 98%, ES9-17, min. 95 %, 25 mg. Offered by: GLPBio, TargetMol, Biosynth, Chemat, Roth. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso), 250mg.
5-bromo-N-phenylthiophene-2-sulfonamide (CAS 55854-43-8) is a chemical compound with the molecular formula C10H8BrNO2S2 and a molecular weight of 318.2 g/mol. IUPAC name: 5-bromo-N-phenylthiophene-2-sulfonamide. InChIKey: AIZXCKZVUXCHAP-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2S2 |
|---|---|
| Molecular weight | 318.2 g/mol |
| IUPAC name | 5-bromo-N-phenylthiophene-2-sulfonamide |
| InChIKey | AIZXCKZVUXCHAP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NS(=O)(=O)C2=CC=C(S2)Br |
Computed by PubChem (NCBI)