cas: 186772-44-1 — see every product listed under this CAS number, including other names
ETHYL 3-BROMO-5-IODOBENZOATE (CAS 186772-44-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F333926-1G |
| cas | 186772-44-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1263.11 Pln | |
| Fluorochem | 5g | 3652.90 Pln |
| delivery time | 3-4 weeks |
|---|
Ethyl 3-bromo-5-iodobenzoate (CAS 186772-44-1) is a chemical compound with the molecular formula C9H8BrIO2 and a molecular weight of 354.97 g/mol. IUPAC name: ethyl 3-bromo-5-iodobenzoate. InChIKey: NNVNNDSFPUBHBM-UHFFFAOYSA-N.
| Molecular formula | C9H8BrIO2 |
|---|---|
| Molecular weight | 354.97 g/mol |
| IUPAC name | ethyl 3-bromo-5-iodobenzoate |
| InChIKey | NNVNNDSFPUBHBM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC(=C1)I)Br |
Computed by PubChem (NCBI)