CAS 450412-27-8 appears in our catalog under these names: Ethyl 5-bromo-2-iodobenzoate, 95%, Ethyl 5–bromo–2–iodobenzoate, Ethyl 5-bromo-2-iodobenzoate 95%, Ethyl 5-bromo-2-iodobenzoate, 95%, 95%, Ethyl 5-Bromo-2-iodobenzoate, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 100mg.
Ethyl 5-bromo-2-iodobenzoate (CAS 450412-27-8) is a chemical compound with the molecular formula C9H8BrIO2 and a molecular weight of 354.97 g/mol. IUPAC name: ethyl 5-bromo-2-iodobenzoate. InChIKey: JWUQSSZXGVRFDZ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrIO2 |
|---|---|
| Molecular weight | 354.97 g/mol |
| IUPAC name | ethyl 5-bromo-2-iodobenzoate |
| InChIKey | JWUQSSZXGVRFDZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)Br)I |
Computed by PubChem (NCBI)