CAS 186772-44-1 appears in our catalog under these names: 3-Bromo-5-iodo-benzoic acid ethyl ester, 95%, Ethyl 3-bromo-5-iodobenzoate, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 10g, 25g, 1g.
Ethyl 3-bromo-5-iodobenzoate (CAS 186772-44-1) is a chemical compound with the molecular formula C9H8BrIO2 and a molecular weight of 354.97 g/mol. IUPAC name: ethyl 3-bromo-5-iodobenzoate. InChIKey: NNVNNDSFPUBHBM-UHFFFAOYSA-N.
| Molecular formula | C9H8BrIO2 |
|---|---|
| Molecular weight | 354.97 g/mol |
| IUPAC name | ethyl 3-bromo-5-iodobenzoate |
| InChIKey | NNVNNDSFPUBHBM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC(=C1)I)Br |
Computed by PubChem (NCBI)