cas: 1965308-78-4 — see every product listed under this CAS number, including other names
ETHYL 6-METHOXY-1,2,3,4-TETRAHYDROISOQUINOLINE-1-CARBOXYLATE HCL, 97% (CAS 1965308-78-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F537474-50MG |
| cas | 1965308-78-4 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 476.93 Pln | |
| Fluorochem | 100mg | 690.40 Pln | |
| Fluorochem | 250mg | 1320.39 Pln | |
| Fluorochem | 500mg | 2580.36 Pln | |
| Fluorochem | 1g | 3418.61 Pln | |
| Fluorochem | 5g | 16877.41 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 6-methoxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylate;hydrochloride (CAS 1965308-78-4) is a chemical compound with the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. IUPAC name: ethyl 6-methoxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylate;hydrochloride. InChIKey: MOKXMIFHJZBWMX-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO3 |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | ethyl 6-methoxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylate;hydrochloride |
| InChIKey | MOKXMIFHJZBWMX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1C2=C(CCN1)C=C(C=C2)OC.Cl |
Computed by PubChem (NCBI)