cas: 92673-40-0 — see every product listed under this CAS number, including other names
ETHYL 7-AMINO[1,2,4]TRIAZOLO[1,5-A]PYRIMIDINE-6-CARBOXYLATE, 98%, 98% (CAS 92673-40-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117EXS-100mg |
| cas | 92673-40-0 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 472.40 Pln | |
| Chemat | 1g | 832.40 Pln | |
| Chemat | 5g | 1854.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 7-amino-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (CAS 92673-40-0) is a chemical compound with the molecular formula C8H9N5O2 and a molecular weight of 207.19 g/mol. IUPAC name: ethyl 7-amino-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate. InChIKey: WXSXMQHHGMMINY-UHFFFAOYSA-N.
| Molecular formula | C8H9N5O2 |
|---|---|
| Molecular weight | 207.19 g/mol |
| IUPAC name | ethyl 7-amino-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| InChIKey | WXSXMQHHGMMINY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N2C(=NC=N2)N=C1)N |
Computed by PubChem (NCBI)