cas: 92673-40-0 — see every product listed under this CAS number, including other names
ethyl 7-amino[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate, 98% (CAS 92673-40-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F366503-100MG |
| cas | 92673-40-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 320.74 Pln | |
| Fluorochem | 250mg | 450.90 Pln | |
| Fluorochem | 500mg | 674.78 Pln | |
| Fluorochem | 1g | 846.59 Pln | |
| Fluorochem | 2.5g | 1237.08 Pln | |
| Fluorochem | 5g | 1903.51 Pln | |
| Fluorochem | 10g | 2736.55 Pln | |
| Fluorochem | 25g | 5693.85 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 7-amino-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (CAS 92673-40-0) is a chemical compound with the molecular formula C8H9N5O2 and a molecular weight of 207.19 g/mol. IUPAC name: ethyl 7-amino-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate. InChIKey: WXSXMQHHGMMINY-UHFFFAOYSA-N.
| Molecular formula | C8H9N5O2 |
|---|---|
| Molecular weight | 207.19 g/mol |
| IUPAC name | ethyl 7-amino-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| InChIKey | WXSXMQHHGMMINY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N2C(=NC=N2)N=C1)N |
Computed by PubChem (NCBI)