Products 6841-01-6

CAS 6841-01-6 is the registry number for Ethyl 4-aminopyrazolo[5,1-c][1,2,4]triazine-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 4-aminopyrazolo[5,1-c][1,2,4]triazine-3-carboxylate (CAS 6841-01-6) is a chemical compound with the molecular formula C8H9N5O2 and a molecular weight of 207.19 g/mol. IUPAC name: ethyl 4-aminopyrazolo[5,1-c][1,2,4]triazine-3-carboxylate. InChIKey: QJDZRXLGQGLJIY-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9N5O2
Molecular weight207.19 g/mol
IUPAC nameethyl 4-aminopyrazolo[5,1-c][1,2,4]triazine-3-carboxylate
InChIKeyQJDZRXLGQGLJIY-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(N2C(=CC=N2)N=N1)N

Computed by PubChem (NCBI)