ElteN378
cas: 1421366-99-5 — see every product listed under this CAS number, including other names
ElteN378 (CAS 1421366-99-5) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 1mg, 25mg, 10mg, 10mM (in 1ml dmso), 200mg, 50mg, 100mg. Offered by: GLPBio, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC75306-5 |
| cas | 1421366-99-5 |
| size | 5mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| GLPBio | 5mg | 1785.89 Pln | |
| GLPBio | 1mg | 1027.65 Pln | |
| GLPBio | 25mg | 5960.89 Pln | |
| GLPBio | 5mg | 1785.89 Pln | |
| GLPBio | 1mg | 1027.65 Pln | |
| GLPBio | 10mg | 2436.48 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 1556.54 Pln | |
| Chemat | 200mg | 10595.60 Pln | |
| Chemat | 1mg | 539.60 Pln | |
| Chemat | 5mg | 1163.60 Pln | |
| Chemat | 10mg | 1691.60 Pln | |
| Chemat | 25mg | 2642.00 Pln | |
| Chemat | 50mg | 3544.40 Pln | |
| Chemat | 100mg | 4725.20 Pln |
properties
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S)-1-(2-oxo-2-phenylacetyl)-N-(3-phenylpropyl)piperidine-2-carboxamide (CAS 1421366-99-5) is a chemical compound with the molecular formula C23H26N2O3 and a molecular weight of 378.5 g/mol. IUPAC name: (2S)-1-(2-oxo-2-phenylacetyl)-N-(3-phenylpropyl)piperidine-2-carboxamide. InChIKey: QXYDCLICGYMGIX-FQEVSTJZSA-N.
| Molecular formula | C23H26N2O3 |
|---|---|
| Molecular weight | 378.5 g/mol |
| IUPAC name | (2S)-1-(2-oxo-2-phenylacetyl)-N-(3-phenylpropyl)piperidine-2-carboxamide |
| InChIKey | QXYDCLICGYMGIX-FQEVSTJZSA-N |
| SMILES | C1CCN([C@@H](C1)C(=O)NCCCC2=CC=CC=C2)C(=O)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)