Products 1421366-99-5
CAS 1421366-99-5 appears in our catalog under these names: ElteN378, ElteN378/ 98.09% (existing batch purity), 1-(2-Oxo-2-phenylacetyl)-N-(3-phenylpropyl)piperidine-2-carboxamide, ElteN378, 99.96%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 25mg, 10mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
(2S)-1-(2-oxo-2-phenylacetyl)-N-(3-phenylpropyl)piperidine-2-carboxamide (CAS 1421366-99-5) is a chemical compound with the molecular formula C23H26N2O3 and a molecular weight of 378.5 g/mol. IUPAC name: (2S)-1-(2-oxo-2-phenylacetyl)-N-(3-phenylpropyl)piperidine-2-carboxamide. InChIKey: QXYDCLICGYMGIX-FQEVSTJZSA-N.
| Molecular formula | C23H26N2O3 |
|---|---|
| Molecular weight | 378.5 g/mol |
| IUPAC name | (2S)-1-(2-oxo-2-phenylacetyl)-N-(3-phenylpropyl)piperidine-2-carboxamide |
| InChIKey | QXYDCLICGYMGIX-FQEVSTJZSA-N |
| SMILES | C1CCN([C@@H](C1)C(=O)NCCCC2=CC=CC=C2)C(=O)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)