CAS 1995067-59-8 appears in our catalog under these names: Emlenoflast/ 98.34% (existing batch purity), MCC–7840, Emlenoflast, Emlenoflast 98%, N-((1,2,3,5,6,7-Hexahydro-s-indacen-4-yl)carbamoyl)-1-isopropyl-1H-pyrazole-3-sulfonamide. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 25mg, 5mg, 50mg, 100mg, 250mg, 10mg, 50 mg.
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-(1-propan-2-ylpyrazol-3-yl)sulfonylurea (CAS 1995067-59-8) is a chemical compound with the molecular formula C19H24N4O3S and a molecular weight of 388.5 g/mol. IUPAC name: 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-(1-propan-2-ylpyrazol-3-yl)sulfonylurea. InChIKey: MTOUOUSKXWSTAX-UHFFFAOYSA-N.
| Molecular formula | C19H24N4O3S |
|---|---|
| Molecular weight | 388.5 g/mol |
| IUPAC name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-(1-propan-2-ylpyrazol-3-yl)sulfonylurea |
| InChIKey | MTOUOUSKXWSTAX-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=CC(=N1)S(=O)(=O)NC(=O)NC2=C3CCCC3=CC4=C2CCC4 |
Computed by PubChem (NCBI)